C17H13N3O — CID 56941125
2-(4-methyl-3-pyridinyl)-5H-pyrido[4,3-b]indol-1-one (PubChem CID 56941125) has the molecular formula C17H13N3O and a molecular weight of 275.31 g/mol. Its IUPAC name is 2-(4-methyl-3-pyridinyl)-5H-pyrido[4,3-b]indol-1-one.
| Compound Name | 2-(4-methyl-3-pyridinyl)-5H-pyrido[4,3-b]indol-1-one |
|---|---|
| PubChem CID | 56941125 |
| Molecular Formula | C17H13N3O |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 2-(4-methyl-3-pyridinyl)-5H-pyrido[4,3-b]indol-1-one |
| SMILES | Cc1ccncc1-n1ccc2[nH]c3ccccc3c2c1=O |
| InChI | InChI=1S/C17H13N3O/c1-11-6-8-18-10-15(11)20-9-7-14-16(17(20)21)12-4-2-3-5-13(12)19-14/h2-10,19H,1H3 |
| InChIKey | MMRQPEMIYFAXGI-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |