About hexadecyl-di(propan-2-yl)azanium;octadecanoate
hexadecyl-di(propan-2-yl)azanium;octadecanoate (PubChem CID 134501364) has the molecular formula C40H83NO2
and a molecular weight of 610.11 g/mol. Its IUPAC name is hexadecyl-di(propan-2-yl)azanium;octadecanoate.
Molecular Properties
| Compound Name | hexadecyl-di(propan-2-yl)azanium;octadecanoate |
| PubChem CID | 134501364 |
| Molecular Formula | C40H83NO2 |
| Molecular Weight | 610.11 g/mol |
| Exact Mass | 609.64 |
| IUPAC Name | hexadecyl-di(propan-2-yl)azanium;octadecanoate |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)[O-].CCCCCCCCCCCCCCCC[NH+](C(C)C)C(C)C |
| InChI | InChI=1S/C22H47N.C18H36O2/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23(21(2)3)22(4)5;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h21-22H,6-20H2,1-5H3;2-17H2,1H3,(H,19,20) |
| InChIKey | PTXNKBMFRGTAAI-UHFFFAOYSA-N |
| XLogP | 11.17 |
| TPSA | 44.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 610.11 |
| LogP ≤ 5 | 11.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexadecyl-di(propan-2-yl)azanium;octadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexadecyl-di(propan-2-yl)azanium;octadecanoate?
The IUPAC name of hexadecyl-di(propan-2-yl)azanium;octadecanoate (CID 134501364) is hexadecyl-di(propan-2-yl)azanium;octadecanoate.
What is the SMILES notation for hexadecyl-di(propan-2-yl)azanium;octadecanoate?
The canonical SMILES for hexadecyl-di(propan-2-yl)azanium;octadecanoate is CCCCCCCCCCCCCCCCCC(=O)[O-].CCCCCCCCCCCCCCCC[NH+](C(C)C)C(C)C.
What is the InChIKey of hexadecyl-di(propan-2-yl)azanium;octadecanoate?
The InChIKey is PTXNKBMFRGTAAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H47N.C18H36O2/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23(21(2)3)22(4)5;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h21-22H,6-20H2,1-5H3;2-17H2,1H3,(H,19,20).
What are the key properties of hexadecyl-di(propan-2-yl)azanium;octadecanoate?
hexadecyl-di(propan-2-yl)azanium;octadecanoate has a molecular weight of 610.11 g/mol, XLogP of 11.17, 33 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexadecyl-di(propan-2-yl)azanium;octadecanoate is sourced from PubChem (CID 134501364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).