C28H37F3N2O3 — CID 134502059
1-[(1S,3S)-2-(2,2-difluoro-3-hydroxypropyl)-1-[(3Z,5E)-5-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]hepta-1,3,5-trien-2-yl]-3-methyl-3,4-dihydro-1H-isoquinolin-6-yl]ethanone (PubChem CID 134502059) has the molecular formula C28H37F3N2O3 and a molecular weight of 506.61 g/mol. Its IUPAC name is 1-[(1S,3S)-2-(2,2-difluoro-3-hydroxypropyl)-1-[(3Z,5E)-5-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]hepta-1,3,5-trien-2-yl]-3-methyl-3,4-dihydro-1H-isoquinolin-6-yl]ethanone.
| Compound Name | 1-[(1S,3S)-2-(2,2-difluoro-3-hydroxypropyl)-1-[(3Z,5E)-5-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]hepta-1,3,5-trien-2-yl]-3-methyl-3,4-dihydro-1H-isoquinolin-6-yl]ethanone |
|---|---|
| PubChem CID | 134502059 |
| Molecular Formula | C28H37F3N2O3 |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.28 |
| IUPAC Name | 1-[(1S,3S)-2-(2,2-difluoro-3-hydroxypropyl)-1-[(3Z,5E)-5-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]hepta-1,3,5-trien-2-yl]-3-methyl-3,4-dihydro-1H-isoquinolin-6-yl]ethanone |
| SMILES | C=C(/C=C\C(=C/C)OCCN1CC(CF)C1)[C@H]1c2ccc(C(C)=O)cc2C[C@H](C)N1CC(F)(F)CO |
| InChI | InChI=1S/C28H37F3N2O3/c1-5-25(36-11-10-32-15-22(14-29)16-32)8-6-19(2)27-26-9-7-23(21(4)35)13-24(26)12-20(3)33(27)17-28(30,31)18-34/h5-9,13,20,22,27,34H,2,10-12,14-18H2,1,3-4H3/b8-6-,25-5+/t20-,27-/m0/s1 |
| InChIKey | NFBCWPWYPAMTSI-POAGRVKUSA-N |
| XLogP | 4.74 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|