C9H13N3 — CID 134502115
2-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]guanidine (PubChem CID 134502115) has the molecular formula C9H13N3 and a molecular weight of 163.22 g/mol. Its IUPAC name is 2-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]guanidine.
| Compound Name | 2-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]guanidine |
|---|---|
| PubChem CID | 134502115 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 2-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]guanidine |
| SMILES | C=C/C=C\C(=C/C=C)N=C(N)N |
| InChI | InChI=1S/C9H13N3/c1-3-5-7-8(6-4-2)12-9(10)11/h3-7H,1-2H2,(H4,10,11,12)/b7-5-,8-6+ |
| InChIKey | LZJWOHORMKGYMW-CGXWXWIYSA-N |
| XLogP | 1.07 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|