C15H20FN3O3S — CID 134508428
N'-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-2-fluoro-N-hydroxy-4-methylsulfonylbenzenecarboximidamide (PubChem CID 134508428) has the molecular formula C15H20FN3O3S and a molecular weight of 341.41 g/mol. Its IUPAC name is N'-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-2-fluoro-N-hydroxy-4-methylsulfonylbenzenecarboximidamide.
| Compound Name | N'-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-2-fluoro-N-hydroxy-4-methylsulfonylbenzenecarboximidamide |
|---|---|
| PubChem CID | 134508428 |
| Molecular Formula | C15H20FN3O3S |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | N'-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-2-fluoro-N-hydroxy-4-methylsulfonylbenzenecarboximidamide |
| SMILES | CS(=O)(=O)c1ccc(/C(=N/[C@@H]2CN3CCC2CC3)NO)c(F)c1 |
| InChI | InChI=1S/C15H20FN3O3S/c1-23(21,22)11-2-3-12(13(16)8-11)15(18-20)17-14-9-19-6-4-10(14)5-7-19/h2-3,8,10,14,20H,4-7,9H2,1H3,(H,17,18)/t14-/m1/s1 |
| InChIKey | FBIBQEPJKWTGQM-CQSZACIVSA-N |
| XLogP | 1.05 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|