C14H17F2N3O — CID 134508340
N'-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-2,4-difluoro-N-hydroxybenzenecarboximidamide (PubChem CID 134508340) has the molecular formula C14H17F2N3O and a molecular weight of 281.31 g/mol. Its IUPAC name is N'-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-2,4-difluoro-N-hydroxybenzenecarboximidamide.
| Compound Name | N'-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-2,4-difluoro-N-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 134508340 |
| Molecular Formula | C14H17F2N3O |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | N'-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-2,4-difluoro-N-hydroxybenzenecarboximidamide |
| SMILES | ON/C(=N\[C@H]1CN2CCC1CC2)c1ccc(F)cc1F |
| InChI | InChI=1S/C14H17F2N3O/c15-10-1-2-11(12(16)7-10)14(18-20)17-13-8-19-5-3-9(13)4-6-19/h1-2,7,9,13,20H,3-6,8H2,(H,17,18)/t13-/m0/s1 |
| InChIKey | SLLQUTMIOBDDKY-ZDUSSCGKSA-N |
| XLogP | 1.78 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|