C15H16ClFN4O — CID 134508445
N'-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-4-chloro-3-cyano-2-fluoro-N-hydroxybenzenecarboximidamide (PubChem CID 134508445) has the molecular formula C15H16ClFN4O and a molecular weight of 322.77 g/mol. Its IUPAC name is N'-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-4-chloro-3-cyano-2-fluoro-N-hydroxybenzenecarboximidamide.
| Compound Name | N'-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-4-chloro-3-cyano-2-fluoro-N-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 134508445 |
| Molecular Formula | C15H16ClFN4O |
| Molecular Weight | 322.77 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | N'-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-4-chloro-3-cyano-2-fluoro-N-hydroxybenzenecarboximidamide |
| SMILES | N#Cc1c(Cl)ccc(/C(=N/[C@H]2CN3CCC2CC3)NO)c1F |
| InChI | InChI=1S/C15H16ClFN4O/c16-12-2-1-10(14(17)11(12)7-18)15(20-22)19-13-8-21-5-3-9(13)4-6-21/h1-2,9,13,22H,3-6,8H2,(H,19,20)/t13-/m0/s1 |
| InChIKey | YQPFZTHPRVPSJB-ZDUSSCGKSA-N |
| XLogP | 2.17 |
| TPSA | 71.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.77 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|