C6H9NO2 — CID 134526764
2,4-dimethyl-4,5-dihydro-1,3-oxazin-6-one (PubChem CID 134526764) has the molecular formula C6H9NO2 and a molecular weight of 127.14 g/mol. Its IUPAC name is 2,4-dimethyl-4,5-dihydro-1,3-oxazin-6-one.
| Compound Name | 2,4-dimethyl-4,5-dihydro-1,3-oxazin-6-one |
|---|---|
| PubChem CID | 134526764 |
| Molecular Formula | C6H9NO2 |
| Molecular Weight | 127.14 g/mol |
| Exact Mass | 127.06 |
| IUPAC Name | 2,4-dimethyl-4,5-dihydro-1,3-oxazin-6-one |
| SMILES | CC1=NC(C)CC(=O)O1 |
| InChI | InChI=1S/C6H9NO2/c1-4-3-6(8)9-5(2)7-4/h4H,3H2,1-2H3 |
| InChIKey | FTXMYMCSKVGPNE-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.14 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |