C5H5NO3 — CID 58133366
2-methyl-1,3-oxazine-4,6-dione (PubChem CID 58133366) has the molecular formula C5H5NO3 and a molecular weight of 127.10 g/mol. Its IUPAC name is 2-methyl-1,3-oxazine-4,6-dione.
| Compound Name | 2-methyl-1,3-oxazine-4,6-dione |
|---|---|
| PubChem CID | 58133366 |
| Molecular Formula | C5H5NO3 |
| Molecular Weight | 127.10 g/mol |
| Exact Mass | 127.03 |
| IUPAC Name | 2-methyl-1,3-oxazine-4,6-dione |
| SMILES | CC1=NC(=O)CC(=O)O1 |
| InChI | InChI=1S/C5H5NO3/c1-3-6-4(7)2-5(8)9-3/h2H2,1H3 |
| InChIKey | KLMJXILBYMKIIA-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.10 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|