About 4-bromo-6-fluoro-2-iodopyrido[3,2-e]thiazine
4-bromo-6-fluoro-2-iodopyrido[3,2-e]thiazine (PubChem CID 134526901) has the molecular formula C7H3BrFIN2S
and a molecular weight of 372.99 g/mol. Its IUPAC name is 4-bromo-6-fluoro-2-iodopyrido[3,2-e]thiazine.
Molecular Properties
| Compound Name | 4-bromo-6-fluoro-2-iodopyrido[3,2-e]thiazine |
| PubChem CID | 134526901 |
| Molecular Formula | C7H3BrFIN2S |
| Molecular Weight | 372.99 g/mol |
| Exact Mass | 371.82 |
| IUPAC Name | 4-bromo-6-fluoro-2-iodopyrido[3,2-e]thiazine |
| SMILES | Fc1cnc2c(c1)C(Br)=CN(I)S2 |
| InChI | InChI=1S/C7H3BrFIN2S/c8-6-3-12(10)13-7-5(6)1-4(9)2-11-7/h1-3H |
| InChIKey | KPFGETXVPYPWFG-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.99 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-6-fluoro-2-iodopyrido[3,2-e]thiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-6-fluoro-2-iodopyrido[3,2-e]thiazine?
The IUPAC name of 4-bromo-6-fluoro-2-iodopyrido[3,2-e]thiazine (CID 134526901) is 4-bromo-6-fluoro-2-iodopyrido[3,2-e]thiazine.
What is the SMILES notation for 4-bromo-6-fluoro-2-iodopyrido[3,2-e]thiazine?
The canonical SMILES for 4-bromo-6-fluoro-2-iodopyrido[3,2-e]thiazine is Fc1cnc2c(c1)C(Br)=CN(I)S2.
What is the InChIKey of 4-bromo-6-fluoro-2-iodopyrido[3,2-e]thiazine?
The InChIKey is KPFGETXVPYPWFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3BrFIN2S/c8-6-3-12(10)13-7-5(6)1-4(9)2-11-7/h1-3H.
What are the key properties of 4-bromo-6-fluoro-2-iodopyrido[3,2-e]thiazine?
4-bromo-6-fluoro-2-iodopyrido[3,2-e]thiazine has a molecular weight of 372.99 g/mol, XLogP of 3.59, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-6-fluoro-2-iodopyrido[3,2-e]thiazine is sourced from PubChem (CID 134526901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).