C7H4FIN2 — CID 58065607
3-fluoro-5-iodo-7H-pyrrolo[3,4-b]pyridine (PubChem CID 58065607) has the molecular formula C7H4FIN2 and a molecular weight of 262.02 g/mol. Its IUPAC name is 3-fluoro-5-iodo-7H-pyrrolo[3,4-b]pyridine.
| Compound Name | 3-fluoro-5-iodo-7H-pyrrolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 58065607 |
| Molecular Formula | C7H4FIN2 |
| Molecular Weight | 262.02 g/mol |
| Exact Mass | 261.94 |
| IUPAC Name | 3-fluoro-5-iodo-7H-pyrrolo[3,4-b]pyridine |
| SMILES | Fc1cnc2c(c1)C(I)=NC2 |
| InChI | InChI=1S/C7H4FIN2/c8-4-1-5-6(10-2-4)3-11-7(5)9/h1-2H,3H2 |
| InChIKey | UNFSBIZNZKZCBC-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.02 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|