About 3-fluoro-7,8-dihydro-5H-thiopyrano[4,3-b]pyridine
3-fluoro-7,8-dihydro-5H-thiopyrano[4,3-b]pyridine (PubChem CID 84653474) has the molecular formula C8H8FNS
and a molecular weight of 169.22 g/mol. Its IUPAC name is 3-fluoro-7,8-dihydro-5H-thiopyrano[4,3-b]pyridine.
Analyze 3-fluoro-7,8-dihydro-5H-thiopyrano[4,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-7,8-dihydro-5H-thiopyrano[4,3-b]pyridine?
The IUPAC name of 3-fluoro-7,8-dihydro-5H-thiopyrano[4,3-b]pyridine (CID 84653474) is 3-fluoro-7,8-dihydro-5H-thiopyrano[4,3-b]pyridine.
What is the SMILES notation for 3-fluoro-7,8-dihydro-5H-thiopyrano[4,3-b]pyridine?
The canonical SMILES for 3-fluoro-7,8-dihydro-5H-thiopyrano[4,3-b]pyridine is Fc1cnc2c(c1)CSCC2.
What is the InChIKey of 3-fluoro-7,8-dihydro-5H-thiopyrano[4,3-b]pyridine?
The InChIKey is IWSFRLNRBZNGJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8FNS/c9-7-3-6-5-11-2-1-8(6)10-4-7/h3-4H,1-2,5H2.
What are the key properties of 3-fluoro-7,8-dihydro-5H-thiopyrano[4,3-b]pyridine?
3-fluoro-7,8-dihydro-5H-thiopyrano[4,3-b]pyridine has a molecular weight of 169.22 g/mol, XLogP of 2.01, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-7,8-dihydro-5H-thiopyrano[4,3-b]pyridine is sourced from PubChem (CID 84653474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).