C7H5FN2OS — CID 142907207
6-fluoro-1,4-dihydropyrido[2,3-d][1,3]thiazin-2-one (PubChem CID 142907207) has the molecular formula C7H5FN2OS and a molecular weight of 184.19 g/mol. Its IUPAC name is 6-fluoro-1,4-dihydropyrido[2,3-d][1,3]thiazin-2-one.
| Compound Name | 6-fluoro-1,4-dihydropyrido[2,3-d][1,3]thiazin-2-one |
|---|---|
| PubChem CID | 142907207 |
| Molecular Formula | C7H5FN2OS |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.01 |
| IUPAC Name | 6-fluoro-1,4-dihydropyrido[2,3-d][1,3]thiazin-2-one |
| SMILES | O=C1Nc2ncc(F)cc2CS1 |
| InChI | InChI=1S/C7H5FN2OS/c8-5-1-4-3-12-7(11)10-6(4)9-2-5/h1-2H,3H2,(H,9,10,11) |
| InChIKey | ZEVYABADGBHWMX-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|