C7H4FN2+ — CID 58259292
5-fluoro-1,2-dihydropyrrolo[2,3-b]pyridin-2-ylium (PubChem CID 58259292) has the molecular formula C7H4FN2+ and a molecular weight of 135.12 g/mol. Its IUPAC name is 5-fluoro-1,2-dihydropyrrolo[2,3-b]pyridin-2-ylium.
| Compound Name | 5-fluoro-1,2-dihydropyrrolo[2,3-b]pyridin-2-ylium |
|---|---|
| PubChem CID | 58259292 |
| Molecular Formula | C7H4FN2+ |
| Molecular Weight | 135.12 g/mol |
| Exact Mass | 135.04 |
| IUPAC Name | 5-fluoro-1,2-dihydropyrrolo[2,3-b]pyridin-2-ylium |
| SMILES | Fc1cnc2c(c1)C=[C+]N2 |
| InChI | InChI=1S/C7H4FN2/c8-6-3-5-1-2-9-7(5)10-4-6/h1,3-4H,(H,9,10)/q+1 |
| InChIKey | OUONMOVSCSQLIT-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.12 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|