C8H9FIN2- — CID 176960972
3-fluoro-6-methyliodanuidyl-5,7-dihydropyrrolo[3,4-b]pyridine (PubChem CID 176960972) has the molecular formula C8H9FIN2- and a molecular weight of 279.08 g/mol. Its IUPAC name is 3-fluoro-6-methyliodanuidyl-5,7-dihydropyrrolo[3,4-b]pyridine.
| Compound Name | 3-fluoro-6-methyliodanuidyl-5,7-dihydropyrrolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 176960972 |
| Molecular Formula | C8H9FIN2- |
| Molecular Weight | 279.08 g/mol |
| Exact Mass | 278.98 |
| IUPAC Name | 3-fluoro-6-methyliodanuidyl-5,7-dihydropyrrolo[3,4-b]pyridine |
| SMILES | C[I-]N1Cc2cc(F)cnc2C1 |
| InChI | InChI=1S/C8H9FIN2/c1-10-12-4-6-2-7(9)3-11-8(6)5-12/h2-3H,4-5H2,1H3/q-1 |
| InChIKey | CLNHQGGNTOOMSR-UHFFFAOYSA-N |
| XLogP | -1.83 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.08 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|