C9H12N2OS — CID 134535441
4-[(1R)-1-isothiocyanatopropyl]-3,5-dimethyl-1,2-oxazole (PubChem CID 134535441) has the molecular formula C9H12N2OS and a molecular weight of 196.27 g/mol. Its IUPAC name is 4-[(1R)-1-isothiocyanatopropyl]-3,5-dimethyl-1,2-oxazole.
| Compound Name | 4-[(1R)-1-isothiocyanatopropyl]-3,5-dimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 134535441 |
| Molecular Formula | C9H12N2OS |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 4-[(1R)-1-isothiocyanatopropyl]-3,5-dimethyl-1,2-oxazole |
| SMILES | CC[C@@H](N=C=S)c1c(C)noc1C |
| InChI | InChI=1S/C9H12N2OS/c1-4-8(10-5-13)9-6(2)11-12-7(9)3/h8H,4H2,1-3H3/t8-/m1/s1 |
| InChIKey | DFEBMYQIDZXPKB-MRVPVSSYSA-N |
| XLogP | 2.85 |
| TPSA | 38.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|