C14H19N7O2 — CID 134536487
3,7-dimethyl-1-[4-(3-methyl-3H-1,2,4-triazol-5-yl)butyl]purine-2,6-dione (PubChem CID 134536487) has the molecular formula C14H19N7O2 and a molecular weight of 317.35 g/mol. Its IUPAC name is 3,7-dimethyl-1-[4-(3-methyl-3H-1,2,4-triazol-5-yl)butyl]purine-2,6-dione.
| Compound Name | 3,7-dimethyl-1-[4-(3-methyl-3H-1,2,4-triazol-5-yl)butyl]purine-2,6-dione |
|---|---|
| PubChem CID | 134536487 |
| Molecular Formula | C14H19N7O2 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 3,7-dimethyl-1-[4-(3-methyl-3H-1,2,4-triazol-5-yl)butyl]purine-2,6-dione |
| SMILES | CC1N=NC(CCCCn2c(=O)c3c(ncn3C)n(C)c2=O)=N1 |
| InChI | InChI=1S/C14H19N7O2/c1-9-16-10(18-17-9)6-4-5-7-21-13(22)11-12(15-8-19(11)2)20(3)14(21)23/h8-9H,4-7H2,1-3H3 |
| InChIKey | ZPJLBRRDOSCGBX-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 98.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|