C16H15FO6 — CID 134542122
butyl 2-fluoro-3,4,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylate (PubChem CID 134542122) has the molecular formula C16H15FO6 and a molecular weight of 322.29 g/mol. Its IUPAC name is butyl 2-fluoro-3,4,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylate.
| Compound Name | butyl 2-fluoro-3,4,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylate |
|---|---|
| PubChem CID | 134542122 |
| Molecular Formula | C16H15FO6 |
| Molecular Weight | 322.29 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | butyl 2-fluoro-3,4,5-trihydroxy-6-oxobenzo[7]annulene-8-carboxylate |
| SMILES | CCCCOC(=O)c1cc(=O)c(O)c2c(O)c(O)c(F)cc2c1 |
| InChI | InChI=1S/C16H15FO6/c1-2-3-4-23-16(22)9-5-8-6-10(17)13(19)15(21)12(8)14(20)11(18)7-9/h5-7,19,21H,2-4H2,1H3,(H,18,20) |
| InChIKey | JIUZLGCCLYIFHG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.29 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|