C17H22N2O4 — CID 134548092
(2-ethoxy-6-nitrophenyl)methyl N-[(2Z,4E)-hexa-2,4-dien-2-yl]ethanimidate (PubChem CID 134548092) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is (2-ethoxy-6-nitrophenyl)methyl N-[(2Z,4E)-hexa-2,4-dien-2-yl]ethanimidate.
| Compound Name | (2-ethoxy-6-nitrophenyl)methyl N-[(2Z,4E)-hexa-2,4-dien-2-yl]ethanimidate |
|---|---|
| PubChem CID | 134548092 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | (2-ethoxy-6-nitrophenyl)methyl N-[(2Z,4E)-hexa-2,4-dien-2-yl]ethanimidate |
| SMILES | C/C=C/C=C(C)\N=C(/C)OCc1c(OCC)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H22N2O4/c1-5-7-9-13(3)18-14(4)23-12-15-16(19(20)21)10-8-11-17(15)22-6-2/h5,7-11H,6,12H2,1-4H3/b7-5+,13-9-,18-14+ |
| InChIKey | YBIVXCSDGVHMQA-LKITXKAJSA-N |
| XLogP | 4.41 |
| TPSA | 73.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|