C18H16F2O2S — CID 134552021
1,1-difluoro-2-(15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)ethanesulfinic acid (PubChem CID 134552021) has the molecular formula C18H16F2O2S and a molecular weight of 334.39 g/mol. Its IUPAC name is 1,1-difluoro-2-(15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)ethanesulfinic acid.
| Compound Name | 1,1-difluoro-2-(15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)ethanesulfinic acid |
|---|---|
| PubChem CID | 134552021 |
| Molecular Formula | C18H16F2O2S |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 1,1-difluoro-2-(15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)ethanesulfinic acid |
| SMILES | O=S(O)C(F)(F)CC1CC2c3ccccc3C1c1ccccc12 |
| InChI | InChI=1S/C18H16F2O2S/c19-18(20,23(21)22)10-11-9-16-12-5-1-3-7-14(12)17(11)15-8-4-2-6-13(15)16/h1-8,11,16-17H,9-10H2,(H,21,22) |
| InChIKey | MZLRRJQLSMKKAO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|