C16H23N3O3 — CID 134557401
6-ethenyl-3-[(4-methoxycyclohexyl)methyl]-1-methyl-5-(methylideneamino)pyrimidine-2,4-dione (PubChem CID 134557401) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is 6-ethenyl-3-[(4-methoxycyclohexyl)methyl]-1-methyl-5-(methylideneamino)pyrimidine-2,4-dione.
| Compound Name | 6-ethenyl-3-[(4-methoxycyclohexyl)methyl]-1-methyl-5-(methylideneamino)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 134557401 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 6-ethenyl-3-[(4-methoxycyclohexyl)methyl]-1-methyl-5-(methylideneamino)pyrimidine-2,4-dione |
| SMILES | C=Cc1c(N=C)c(=O)n(CC2CCC(OC)CC2)c(=O)n1C |
| InChI | InChI=1S/C16H23N3O3/c1-5-13-14(17-2)15(20)19(16(21)18(13)3)10-11-6-8-12(22-4)9-7-11/h5,11-12H,1-2,6-10H2,3-4H3 |
| InChIKey | TVWZHXLCFREDRB-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 65.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|