C18H22O5PS+ — CID 134563015
(3-tert-butyl-3-hydroxy-2H-1,3-benzoxaphosphol-3-ium-4-yl) 4-methylbenzenesulfonate (PubChem CID 134563015) has the molecular formula C18H22O5PS+ and a molecular weight of 381.41 g/mol. Its IUPAC name is (3-tert-butyl-3-hydroxy-2H-1,3-benzoxaphosphol-3-ium-4-yl) 4-methylbenzenesulfonate.
| Compound Name | (3-tert-butyl-3-hydroxy-2H-1,3-benzoxaphosphol-3-ium-4-yl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 134563015 |
| Molecular Formula | C18H22O5PS+ |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | (3-tert-butyl-3-hydroxy-2H-1,3-benzoxaphosphol-3-ium-4-yl) 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2cccc3c2[P+](O)(C(C)(C)C)CO3)cc1 |
| InChI | InChI=1S/C18H22O5PS/c1-13-8-10-14(11-9-13)25(20,21)23-16-7-5-6-15-17(16)24(19,12-22-15)18(2,3)4/h5-11,19H,12H2,1-4H3/q+1 |
| InChIKey | BBTACOHIMNHFNN-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|