C17H17F3N4O — CID 134563834
(3,3-difluoropiperidin-1-yl)-[(5S,7S)-7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]methanone (PubChem CID 134563834) has the molecular formula C17H17F3N4O and a molecular weight of 350.34 g/mol. Its IUPAC name is (3,3-difluoropiperidin-1-yl)-[(5S,7S)-7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]methanone.
| Compound Name | (3,3-difluoropiperidin-1-yl)-[(5S,7S)-7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]methanone |
|---|---|
| PubChem CID | 134563834 |
| Molecular Formula | C17H17F3N4O |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | (3,3-difluoropiperidin-1-yl)-[(5S,7S)-7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]methanone |
| SMILES | O=C(c1nc2n(n1)[C@H](c1ccccc1)C[C@@H]2F)N1CCCC(F)(F)C1 |
| InChI | InChI=1S/C17H17F3N4O/c18-12-9-13(11-5-2-1-3-6-11)24-15(12)21-14(22-24)16(25)23-8-4-7-17(19,20)10-23/h1-3,5-6,12-13H,4,7-10H2/t12-,13-/m0/s1 |
| InChIKey | RDTNQVKOIGALOL-STQMWFEESA-N |
| XLogP | 3.15 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |