C18H18F4N4O — CID 134563842
[(5S,7S)-7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]-[(2S,3S)-2-methyl-3-(trifluoromethyl)pyrrolidin-1-yl]methanone (PubChem CID 134563842) has the molecular formula C18H18F4N4O and a molecular weight of 382.36 g/mol. Its IUPAC name is [(5S,7S)-7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]-[(2S,3S)-2-methyl-3-(trifluoromethyl)pyrrolidin-1-yl]methanone.
| Compound Name | [(5S,7S)-7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]-[(2S,3S)-2-methyl-3-(trifluoromethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 134563842 |
| Molecular Formula | C18H18F4N4O |
| Molecular Weight | 382.36 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | [(5S,7S)-7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]-[(2S,3S)-2-methyl-3-(trifluoromethyl)pyrrolidin-1-yl]methanone |
| SMILES | C[C@H]1[C@@H](C(F)(F)F)CCN1C(=O)c1nc2n(n1)[C@H](c1ccccc1)C[C@@H]2F |
| InChI | InChI=1S/C18H18F4N4O/c1-10-12(18(20,21)22)7-8-25(10)17(27)15-23-16-13(19)9-14(26(16)24-15)11-5-3-2-4-6-11/h2-6,10,12-14H,7-9H2,1H3/t10-,12-,13-,14-/m0/s1 |
| InChIKey | LVYUHWSBDCCOKI-PYJNHQTQSA-N |
| XLogP | 3.69 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.36 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |