C15H15F3N4O — CID 134563980
(5S,7S)-N-(2,2-difluoroethyl)-7-fluoro-N-methyl-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole-2-carboxamide (PubChem CID 134563980) has the molecular formula C15H15F3N4O and a molecular weight of 324.31 g/mol. Its IUPAC name is (5S,7S)-N-(2,2-difluoroethyl)-7-fluoro-N-methyl-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole-2-carboxamide.
| Compound Name | (5S,7S)-N-(2,2-difluoroethyl)-7-fluoro-N-methyl-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole-2-carboxamide |
|---|---|
| PubChem CID | 134563980 |
| Molecular Formula | C15H15F3N4O |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | (5S,7S)-N-(2,2-difluoroethyl)-7-fluoro-N-methyl-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole-2-carboxamide |
| SMILES | CN(CC(F)F)C(=O)c1nc2n(n1)[C@H](c1ccccc1)C[C@@H]2F |
| InChI | InChI=1S/C15H15F3N4O/c1-21(8-12(17)18)15(23)13-19-14-10(16)7-11(22(14)20-13)9-5-3-2-4-6-9/h2-6,10-12H,7-8H2,1H3/t10-,11-/m0/s1 |
| InChIKey | MJFVUNLMLGUQIL-QWRGUYRKSA-N |
| XLogP | 2.62 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |