C15H26N4O2 — CID 134567539
(E,4E)-4-[[formyl(methyl)amino]methylidene]-N,6-dimethyl-7-(methylamino)-5-methyliminooct-2-enamide (PubChem CID 134567539) has the molecular formula C15H26N4O2 and a molecular weight of 294.40 g/mol. Its IUPAC name is (E,4E)-4-[[formyl(methyl)amino]methylidene]-N,6-dimethyl-7-(methylamino)-5-methyliminooct-2-enamide.
| Compound Name | (E,4E)-4-[[formyl(methyl)amino]methylidene]-N,6-dimethyl-7-(methylamino)-5-methyliminooct-2-enamide |
|---|---|
| PubChem CID | 134567539 |
| Molecular Formula | C15H26N4O2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | (E,4E)-4-[[formyl(methyl)amino]methylidene]-N,6-dimethyl-7-(methylamino)-5-methyliminooct-2-enamide |
| SMILES | C/N=C(C(/C=C/C(=O)NC)=C/N(C)C=O)\C(C)C(C)NC |
| InChI | InChI=1S/C15H26N4O2/c1-11(12(2)16-3)15(18-5)13(9-19(6)10-20)7-8-14(21)17-4/h7-12,16H,1-6H3,(H,17,21)/b8-7+,13-9+,18-15+ |
| InChIKey | OGAIZIHYJAWHJN-HPUYOMRWSA-N |
| XLogP | 0.58 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|