C19H30N4O3 — CID 134569296
N-[(Z,4Z)-4-(1-aminoethenylimino)-3-[(3,4-dimethoxy-2-pyridinyl)methoxy]but-2-en-2-yl]pentan-2-amine (PubChem CID 134569296) has the molecular formula C19H30N4O3 and a molecular weight of 362.47 g/mol. Its IUPAC name is N-[(Z,4Z)-4-(1-aminoethenylimino)-3-[(3,4-dimethoxy-2-pyridinyl)methoxy]but-2-en-2-yl]pentan-2-amine.
| Compound Name | N-[(Z,4Z)-4-(1-aminoethenylimino)-3-[(3,4-dimethoxy-2-pyridinyl)methoxy]but-2-en-2-yl]pentan-2-amine |
|---|---|
| PubChem CID | 134569296 |
| Molecular Formula | C19H30N4O3 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | N-[(Z,4Z)-4-(1-aminoethenylimino)-3-[(3,4-dimethoxy-2-pyridinyl)methoxy]but-2-en-2-yl]pentan-2-amine |
| SMILES | C=C(N)/N=C\C(OCc1nccc(OC)c1OC)=C(/C)NC(C)CCC |
| InChI | InChI=1S/C19H30N4O3/c1-7-8-13(2)23-14(3)18(11-22-15(4)20)26-12-16-19(25-6)17(24-5)9-10-21-16/h9-11,13,23H,4,7-8,12,20H2,1-3,5-6H3/b18-14-,22-11- |
| InChIKey | SXSBTJRBUGCVFF-KZYGDEJASA-N |
| XLogP | 3.13 |
| TPSA | 90.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|