C17H31F2NO4 — CID 134579480
3-[2,2-difluoro-3-[3-(3-methoxycyclobutyl)oxypropoxy]propoxy]-1-propan-2-ylazetidine (PubChem CID 134579480) has the molecular formula C17H31F2NO4 and a molecular weight of 351.43 g/mol. Its IUPAC name is 3-[2,2-difluoro-3-[3-(3-methoxycyclobutyl)oxypropoxy]propoxy]-1-propan-2-ylazetidine.
| Compound Name | 3-[2,2-difluoro-3-[3-(3-methoxycyclobutyl)oxypropoxy]propoxy]-1-propan-2-ylazetidine |
|---|---|
| PubChem CID | 134579480 |
| Molecular Formula | C17H31F2NO4 |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | 3-[2,2-difluoro-3-[3-(3-methoxycyclobutyl)oxypropoxy]propoxy]-1-propan-2-ylazetidine |
| SMILES | COC1CC(OCCCOCC(F)(F)COC2CN(C(C)C)C2)C1 |
| InChI | InChI=1S/C17H31F2NO4/c1-13(2)20-9-16(10-20)24-12-17(18,19)11-22-5-4-6-23-15-7-14(8-15)21-3/h13-16H,4-12H2,1-3H3 |
| InChIKey | YYZRAHBINPNAHV-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|