C17H31F2NO3 — CID 134579479
3-[3-[2,2-difluoro-3-(3-methylcyclobutyl)oxypropoxy]propoxy]-1-propan-2-ylazetidine (PubChem CID 134579479) has the molecular formula C17H31F2NO3 and a molecular weight of 335.44 g/mol. Its IUPAC name is 3-[3-[2,2-difluoro-3-(3-methylcyclobutyl)oxypropoxy]propoxy]-1-propan-2-ylazetidine.
| Compound Name | 3-[3-[2,2-difluoro-3-(3-methylcyclobutyl)oxypropoxy]propoxy]-1-propan-2-ylazetidine |
|---|---|
| PubChem CID | 134579479 |
| Molecular Formula | C17H31F2NO3 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.23 |
| IUPAC Name | 3-[3-[2,2-difluoro-3-(3-methylcyclobutyl)oxypropoxy]propoxy]-1-propan-2-ylazetidine |
| SMILES | CC1CC(OCC(F)(F)COCCCOC2CN(C(C)C)C2)C1 |
| InChI | InChI=1S/C17H31F2NO3/c1-13(2)20-9-16(10-20)22-6-4-5-21-11-17(18,19)12-23-15-7-14(3)8-15/h13-16H,4-12H2,1-3H3 |
| InChIKey | FGGZRTSHDUJVSC-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|