C15H27F2NO3 — CID 134581772
3-[3-[2,2-difluoro-3-(3-methylcyclobutyl)oxypropoxy]propoxy]-1-methylazetidine (PubChem CID 134581772) has the molecular formula C15H27F2NO3 and a molecular weight of 307.38 g/mol. Its IUPAC name is 3-[3-[2,2-difluoro-3-(3-methylcyclobutyl)oxypropoxy]propoxy]-1-methylazetidine.
| Compound Name | 3-[3-[2,2-difluoro-3-(3-methylcyclobutyl)oxypropoxy]propoxy]-1-methylazetidine |
|---|---|
| PubChem CID | 134581772 |
| Molecular Formula | C15H27F2NO3 |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | 3-[3-[2,2-difluoro-3-(3-methylcyclobutyl)oxypropoxy]propoxy]-1-methylazetidine |
| SMILES | CC1CC(OCC(F)(F)COCCCOC2CN(C)C2)C1 |
| InChI | InChI=1S/C15H27F2NO3/c1-12-6-13(7-12)21-11-15(16,17)10-19-4-3-5-20-14-8-18(2)9-14/h12-14H,3-11H2,1-2H3 |
| InChIKey | YDWKSOHHZICKBQ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|