C19H39F2NO3 — CID 142390997
3-[3-[2,2-difluoro-3-(3-methylcyclobutyl)oxypropoxy]propoxy]-1-methylazetidine;ethane (PubChem CID 142390997) has the molecular formula C19H39F2NO3 and a molecular weight of 367.52 g/mol. Its IUPAC name is 3-[3-[2,2-difluoro-3-(3-methylcyclobutyl)oxypropoxy]propoxy]-1-methylazetidine;ethane.
| Compound Name | 3-[3-[2,2-difluoro-3-(3-methylcyclobutyl)oxypropoxy]propoxy]-1-methylazetidine;ethane |
|---|---|
| PubChem CID | 142390997 |
| Molecular Formula | C19H39F2NO3 |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.29 |
| IUPAC Name | 3-[3-[2,2-difluoro-3-(3-methylcyclobutyl)oxypropoxy]propoxy]-1-methylazetidine;ethane |
| SMILES | CC.CC.CC1CC(OCC(F)(F)COCCCOC2CN(C)C2)C1 |
| InChI | InChI=1S/C15H27F2NO3.2C2H6/c1-12-6-13(7-12)21-11-15(16,17)10-19-4-3-5-20-14-8-18(2)9-14;2*1-2/h12-14H,3-11H2,1-2H3;2*1-2H3 |
| InChIKey | NFLZSPBIGNXZPO-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|