C19H37F2NO3 — CID 142386103
3-[3-[2,2-difluoro-3-(3-methylcyclobutyl)oxypropoxy]propoxy]-1-ethylazetidine;propane (PubChem CID 142386103) has the molecular formula C19H37F2NO3 and a molecular weight of 365.51 g/mol. Its IUPAC name is 3-[3-[2,2-difluoro-3-(3-methylcyclobutyl)oxypropoxy]propoxy]-1-ethylazetidine;propane.
| Compound Name | 3-[3-[2,2-difluoro-3-(3-methylcyclobutyl)oxypropoxy]propoxy]-1-ethylazetidine;propane |
|---|---|
| PubChem CID | 142386103 |
| Molecular Formula | C19H37F2NO3 |
| Molecular Weight | 365.51 g/mol |
| Exact Mass | 365.27 |
| IUPAC Name | 3-[3-[2,2-difluoro-3-(3-methylcyclobutyl)oxypropoxy]propoxy]-1-ethylazetidine;propane |
| SMILES | CCC.CCN1CC(OCCCOCC(F)(F)COC2CC(C)C2)C1 |
| InChI | InChI=1S/C16H29F2NO3.C3H8/c1-3-19-9-15(10-19)21-6-4-5-20-11-16(17,18)12-22-14-7-13(2)8-14;1-3-2/h13-15H,3-12H2,1-2H3;3H2,1-2H3 |
| InChIKey | CBTYWCGCRGRUFB-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.51 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|