C18H35F2NO4 — CID 142386398
ethane;3-[3-[3-(3-ethoxycyclobutyl)oxypropoxy]-2,2-difluoropropoxy]-1-methylazetidine (PubChem CID 142386398) has the molecular formula C18H35F2NO4 and a molecular weight of 367.48 g/mol. Its IUPAC name is ethane;3-[3-[3-(3-ethoxycyclobutyl)oxypropoxy]-2,2-difluoropropoxy]-1-methylazetidine.
| Compound Name | ethane;3-[3-[3-(3-ethoxycyclobutyl)oxypropoxy]-2,2-difluoropropoxy]-1-methylazetidine |
|---|---|
| PubChem CID | 142386398 |
| Molecular Formula | C18H35F2NO4 |
| Molecular Weight | 367.48 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | ethane;3-[3-[3-(3-ethoxycyclobutyl)oxypropoxy]-2,2-difluoropropoxy]-1-methylazetidine |
| SMILES | CC.CCOC1CC(OCCCOCC(F)(F)COC2CN(C)C2)C1 |
| InChI | InChI=1S/C16H29F2NO4.C2H6/c1-3-21-13-7-14(8-13)22-6-4-5-20-11-16(17,18)12-23-15-9-19(2)10-15;1-2/h13-15H,3-12H2,1-2H3;1-2H3 |
| InChIKey | BWEUJOAFYVVHFP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.48 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|