C18H33F2NO4 — CID 139571984
2-[[2,2-difluoro-3-[3-(3-methoxycyclobutyl)oxypropoxy]propoxy]methyl]-1-propan-2-ylazetidine (PubChem CID 139571984) has the molecular formula C18H33F2NO4 and a molecular weight of 365.46 g/mol. Its IUPAC name is 2-[[2,2-difluoro-3-[3-(3-methoxycyclobutyl)oxypropoxy]propoxy]methyl]-1-propan-2-ylazetidine.
| Compound Name | 2-[[2,2-difluoro-3-[3-(3-methoxycyclobutyl)oxypropoxy]propoxy]methyl]-1-propan-2-ylazetidine |
|---|---|
| PubChem CID | 139571984 |
| Molecular Formula | C18H33F2NO4 |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | 2-[[2,2-difluoro-3-[3-(3-methoxycyclobutyl)oxypropoxy]propoxy]methyl]-1-propan-2-ylazetidine |
| SMILES | COC1CC(OCCCOCC(F)(F)COCC2CCN2C(C)C)C1 |
| InChI | InChI=1S/C18H33F2NO4/c1-14(2)21-6-5-15(21)11-24-13-18(19,20)12-23-7-4-8-25-17-9-16(10-17)22-3/h14-17H,4-13H2,1-3H3 |
| InChIKey | OOJQIVYESDSEDB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|