C27H25F3N4O3S — CID 134584181
N-(4-phenylphenyl)-N-[[4-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]phenyl]methyl]thiomorpholine-4-carboxamide (PubChem CID 134584181) has the molecular formula C27H25F3N4O3S and a molecular weight of 542.58 g/mol. Its IUPAC name is N-(4-phenylphenyl)-N-[[4-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]phenyl]methyl]thiomorpholine-4-carboxamide.
| Compound Name | N-(4-phenylphenyl)-N-[[4-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]phenyl]methyl]thiomorpholine-4-carboxamide |
|---|---|
| PubChem CID | 134584181 |
| Molecular Formula | C27H25F3N4O3S |
| Molecular Weight | 542.58 g/mol |
| Exact Mass | 542.16 |
| IUPAC Name | N-(4-phenylphenyl)-N-[[4-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]phenyl]methyl]thiomorpholine-4-carboxamide |
| SMILES | O=C(NNC(=O)C(F)(F)F)c1ccc(CN(C(=O)N2CCSCC2)c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C27H25F3N4O3S/c28-27(29,30)25(36)32-31-24(35)22-8-6-19(7-9-22)18-34(26(37)33-14-16-38-17-15-33)23-12-10-21(11-13-23)20-4-2-1-3-5-20/h1-13H,14-18H2,(H,31,35)(H,32,36) |
| InChIKey | SHJLRPDLNHKKAS-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.58 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|