C21H20F4N4O4S — CID 134584009
N-(2-fluorophenyl)-N-[[4-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]phenyl]methylsulfanyl]morpholine-4-carboxamide (PubChem CID 134584009) has the molecular formula C21H20F4N4O4S and a molecular weight of 500.47 g/mol. Its IUPAC name is N-(2-fluorophenyl)-N-[[4-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]phenyl]methylsulfanyl]morpholine-4-carboxamide.
| Compound Name | N-(2-fluorophenyl)-N-[[4-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]phenyl]methylsulfanyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 134584009 |
| Molecular Formula | C21H20F4N4O4S |
| Molecular Weight | 500.47 g/mol |
| Exact Mass | 500.11 |
| IUPAC Name | N-(2-fluorophenyl)-N-[[4-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]phenyl]methylsulfanyl]morpholine-4-carboxamide |
| SMILES | O=C(NNC(=O)C(F)(F)F)c1ccc(CSN(C(=O)N2CCOCC2)c2ccccc2F)cc1 |
| InChI | InChI=1S/C21H20F4N4O4S/c22-16-3-1-2-4-17(16)29(20(32)28-9-11-33-12-10-28)34-13-14-5-7-15(8-6-14)18(30)26-27-19(31)21(23,24)25/h1-8H,9-13H2,(H,26,30)(H,27,31) |
| InChIKey | POPSKXPFXDGORV-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.47 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|