C27H30F3N3O — CID 134588857
N-benzhydryl-5-[4-(2-methoxyethyl)piperazin-1-yl]-2-(trifluoromethyl)aniline (PubChem CID 134588857) has the molecular formula C27H30F3N3O and a molecular weight of 469.55 g/mol. Its IUPAC name is N-benzhydryl-5-[4-(2-methoxyethyl)piperazin-1-yl]-2-(trifluoromethyl)aniline.
| Compound Name | N-benzhydryl-5-[4-(2-methoxyethyl)piperazin-1-yl]-2-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 134588857 |
| Molecular Formula | C27H30F3N3O |
| Molecular Weight | 469.55 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | N-benzhydryl-5-[4-(2-methoxyethyl)piperazin-1-yl]-2-(trifluoromethyl)aniline |
| SMILES | COCCN1CCN(c2ccc(C(F)(F)F)c(NC(c3ccccc3)c3ccccc3)c2)CC1 |
| InChI | InChI=1S/C27H30F3N3O/c1-34-19-18-32-14-16-33(17-15-32)23-12-13-24(27(28,29)30)25(20-23)31-26(21-8-4-2-5-9-21)22-10-6-3-7-11-22/h2-13,20,26,31H,14-19H2,1H3 |
| InChIKey | AEKXONIZNPWWLN-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.55 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |