C29H34F3N3 — CID 134589793
N-benzhydryl-5-(4-butyl-1,4-diazepan-1-yl)-2-(trifluoromethyl)aniline (PubChem CID 134589793) has the molecular formula C29H34F3N3 and a molecular weight of 481.61 g/mol. Its IUPAC name is N-benzhydryl-5-(4-butyl-1,4-diazepan-1-yl)-2-(trifluoromethyl)aniline.
| Compound Name | N-benzhydryl-5-(4-butyl-1,4-diazepan-1-yl)-2-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 134589793 |
| Molecular Formula | C29H34F3N3 |
| Molecular Weight | 481.61 g/mol |
| Exact Mass | 481.27 |
| IUPAC Name | N-benzhydryl-5-(4-butyl-1,4-diazepan-1-yl)-2-(trifluoromethyl)aniline |
| SMILES | CCCCN1CCCN(c2ccc(C(F)(F)F)c(NC(c3ccccc3)c3ccccc3)c2)CC1 |
| InChI | InChI=1S/C29H34F3N3/c1-2-3-17-34-18-10-19-35(21-20-34)25-15-16-26(29(30,31)32)27(22-25)33-28(23-11-6-4-7-12-23)24-13-8-5-9-14-24/h4-9,11-16,22,28,33H,2-3,10,17-21H2,1H3 |
| InChIKey | OUOLHKWAGFMRBH-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.61 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |