C20H32F2N2 — CID 176933847
1-[4-butan-2-yl-3-(1,1-difluoroethyl)phenyl]-4-butylpiperazine (PubChem CID 176933847) has the molecular formula C20H32F2N2 and a molecular weight of 338.49 g/mol. Its IUPAC name is 1-[4-butan-2-yl-3-(1,1-difluoroethyl)phenyl]-4-butylpiperazine.
| Compound Name | 1-[4-butan-2-yl-3-(1,1-difluoroethyl)phenyl]-4-butylpiperazine |
|---|---|
| PubChem CID | 176933847 |
| Molecular Formula | C20H32F2N2 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | 1-[4-butan-2-yl-3-(1,1-difluoroethyl)phenyl]-4-butylpiperazine |
| SMILES | CCCCN1CCN(c2ccc(C(C)CC)c(C(C)(F)F)c2)CC1 |
| InChI | InChI=1S/C20H32F2N2/c1-5-7-10-23-11-13-24(14-12-23)17-8-9-18(16(3)6-2)19(15-17)20(4,21)22/h8-9,15-16H,5-7,10-14H2,1-4H3 |
| InChIKey | CBGXAEHWKWKJOD-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |