C29H37N3O2S — CID 134589280
N-benzhydryl-5-[4-(2-methylpropyl)-1,4-diazepan-1-yl]-2-methylsulfonylaniline (PubChem CID 134589280) has the molecular formula C29H37N3O2S and a molecular weight of 491.70 g/mol. Its IUPAC name is N-benzhydryl-5-[4-(2-methylpropyl)-1,4-diazepan-1-yl]-2-methylsulfonylaniline.
| Compound Name | N-benzhydryl-5-[4-(2-methylpropyl)-1,4-diazepan-1-yl]-2-methylsulfonylaniline |
|---|---|
| PubChem CID | 134589280 |
| Molecular Formula | C29H37N3O2S |
| Molecular Weight | 491.70 g/mol |
| Exact Mass | 491.26 |
| IUPAC Name | N-benzhydryl-5-[4-(2-methylpropyl)-1,4-diazepan-1-yl]-2-methylsulfonylaniline |
| SMILES | CC(C)CN1CCCN(c2ccc(S(C)(=O)=O)c(NC(c3ccccc3)c3ccccc3)c2)CC1 |
| InChI | InChI=1S/C29H37N3O2S/c1-23(2)22-31-17-10-18-32(20-19-31)26-15-16-28(35(3,33)34)27(21-26)30-29(24-11-6-4-7-12-24)25-13-8-5-9-14-25/h4-9,11-16,21,23,29-30H,10,17-20,22H2,1-3H3 |
| InChIKey | CBBHZNANEDPYLS-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.70 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |