C25H29N3O2S — CID 134589546
N-benzhydryl-5-(4-methylpiperazin-1-yl)-2-methylsulfonylaniline (PubChem CID 134589546) has the molecular formula C25H29N3O2S and a molecular weight of 435.59 g/mol. Its IUPAC name is N-benzhydryl-5-(4-methylpiperazin-1-yl)-2-methylsulfonylaniline.
| Compound Name | N-benzhydryl-5-(4-methylpiperazin-1-yl)-2-methylsulfonylaniline |
|---|---|
| PubChem CID | 134589546 |
| Molecular Formula | C25H29N3O2S |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | N-benzhydryl-5-(4-methylpiperazin-1-yl)-2-methylsulfonylaniline |
| SMILES | CN1CCN(c2ccc(S(C)(=O)=O)c(NC(c3ccccc3)c3ccccc3)c2)CC1 |
| InChI | InChI=1S/C25H29N3O2S/c1-27-15-17-28(18-16-27)22-13-14-24(31(2,29)30)23(19-22)26-25(20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-14,19,25-26H,15-18H2,1-2H3 |
| InChIKey | UNUQSSJEUSOZNO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |