C24H23F4N3 — CID 134588903
N-benzhydryl-2-fluoro-5-[4-(trifluoromethyl)piperazin-1-yl]aniline (PubChem CID 134588903) has the molecular formula C24H23F4N3 and a molecular weight of 429.46 g/mol. Its IUPAC name is N-benzhydryl-2-fluoro-5-[4-(trifluoromethyl)piperazin-1-yl]aniline.
| Compound Name | N-benzhydryl-2-fluoro-5-[4-(trifluoromethyl)piperazin-1-yl]aniline |
|---|---|
| PubChem CID | 134588903 |
| Molecular Formula | C24H23F4N3 |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | N-benzhydryl-2-fluoro-5-[4-(trifluoromethyl)piperazin-1-yl]aniline |
| SMILES | Fc1ccc(N2CCN(C(F)(F)F)CC2)cc1NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H23F4N3/c25-21-12-11-20(30-13-15-31(16-14-30)24(26,27)28)17-22(21)29-23(18-7-3-1-4-8-18)19-9-5-2-6-10-19/h1-12,17,23,29H,13-16H2 |
| InChIKey | DQKXHIVNNGHOAU-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|