C6H9FO8S2 — CID 134599889
ethyl 3-fluoro-2,2,4,4-tetraoxo-1,5,2,4-dioxadithiepane-6-carboxylate (PubChem CID 134599889) has the molecular formula C6H9FO8S2 and a molecular weight of 292.26 g/mol. Its IUPAC name is ethyl 3-fluoro-2,2,4,4-tetraoxo-1,5,2,4-dioxadithiepane-6-carboxylate.
| Compound Name | ethyl 3-fluoro-2,2,4,4-tetraoxo-1,5,2,4-dioxadithiepane-6-carboxylate |
|---|---|
| PubChem CID | 134599889 |
| Molecular Formula | C6H9FO8S2 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 291.97 |
| IUPAC Name | ethyl 3-fluoro-2,2,4,4-tetraoxo-1,5,2,4-dioxadithiepane-6-carboxylate |
| SMILES | CCOC(=O)C1COS(=O)(=O)C(F)S(=O)(=O)O1 |
| InChI | InChI=1S/C6H9FO8S2/c1-2-13-5(8)4-3-14-16(9,10)6(7)17(11,12)15-4/h4,6H,2-3H2,1H3 |
| InChIKey | KSLLJMDEEMJDTM-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|