C7H12O7S — CID 134599777
3-methoxypropyl 2,2-dioxo-1,3,2-dioxathiolane-4-carboxylate (PubChem CID 134599777) has the molecular formula C7H12O7S and a molecular weight of 240.23 g/mol. Its IUPAC name is 3-methoxypropyl 2,2-dioxo-1,3,2-dioxathiolane-4-carboxylate.
| Compound Name | 3-methoxypropyl 2,2-dioxo-1,3,2-dioxathiolane-4-carboxylate |
|---|---|
| PubChem CID | 134599777 |
| Molecular Formula | C7H12O7S |
| Molecular Weight | 240.23 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | 3-methoxypropyl 2,2-dioxo-1,3,2-dioxathiolane-4-carboxylate |
| SMILES | COCCCOC(=O)C1COS(=O)(=O)O1 |
| InChI | InChI=1S/C7H12O7S/c1-11-3-2-4-12-7(8)6-5-13-15(9,10)14-6/h6H,2-5H2,1H3 |
| InChIKey | GXYADHMQZJFVBE-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.23 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|