About 2-(azepan-3-yl)azocane
2-(azepan-3-yl)azocane (PubChem CID 134601740) has the molecular formula C13H26N2
and a molecular weight of 210.36 g/mol. Its IUPAC name is 2-(azepan-3-yl)azocane.
Molecular Properties
| Compound Name | 2-(azepan-3-yl)azocane |
| PubChem CID | 134601740 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | 2-(azepan-3-yl)azocane |
| SMILES | C1CCCC(C2CCCCNC2)NCC1 |
| InChI | InChI=1S/C13H26N2/c1-2-5-10-15-13(8-3-1)12-7-4-6-9-14-11-12/h12-15H,1-11H2 |
| InChIKey | HCBFOICINULMGI-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(azepan-3-yl)azocane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(azepan-3-yl)azocane?
The IUPAC name of 2-(azepan-3-yl)azocane (CID 134601740) is 2-(azepan-3-yl)azocane.
What is the SMILES notation for 2-(azepan-3-yl)azocane?
The canonical SMILES for 2-(azepan-3-yl)azocane is C1CCCC(C2CCCCNC2)NCC1.
What is the InChIKey of 2-(azepan-3-yl)azocane?
The InChIKey is HCBFOICINULMGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2/c1-2-5-10-15-13(8-3-1)12-7-4-6-9-14-11-12/h12-15H,1-11H2.
What are the key properties of 2-(azepan-3-yl)azocane?
2-(azepan-3-yl)azocane has a molecular weight of 210.36 g/mol, XLogP of 2.30, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(azepan-3-yl)azocane is sourced from PubChem (CID 134601740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).