C8H14N2O — CID 134601795
2-(2-aminocyclopentyl)prop-2-enamide (PubChem CID 134601795) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is 2-(2-aminocyclopentyl)prop-2-enamide.
| Compound Name | 2-(2-aminocyclopentyl)prop-2-enamide |
|---|---|
| PubChem CID | 134601795 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | 2-(2-aminocyclopentyl)prop-2-enamide |
| SMILES | C=C(C(N)=O)C1CCCC1N |
| InChI | InChI=1S/C8H14N2O/c1-5(8(10)11)6-3-2-4-7(6)9/h6-7H,1-4,9H2,(H2,10,11) |
| InChIKey | UERIXIOURKPFPG-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|