C6H13N3O — CID 77052234
2-amino-N'-hydroxycyclopentane-1-carboximidamide (PubChem CID 77052234) has the molecular formula C6H13N3O and a molecular weight of 143.19 g/mol. Its IUPAC name is 2-amino-N'-hydroxycyclopentane-1-carboximidamide.
| Compound Name | 2-amino-N'-hydroxycyclopentane-1-carboximidamide |
|---|---|
| PubChem CID | 77052234 |
| Molecular Formula | C6H13N3O |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.11 |
| IUPAC Name | 2-amino-N'-hydroxycyclopentane-1-carboximidamide |
| SMILES | NC(=NO)C1CCCC1N |
| InChI | InChI=1S/C6H13N3O/c7-5-3-1-2-4(5)6(8)9-10/h4-5,10H,1-3,7H2,(H2,8,9) |
| InChIKey | VSGLCFHCNSAYFZ-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|