C20H23F2N5O — CID 134606162
1-N-[1-(3,5-difluorophenyl)-1,2,4-triazol-3-yl]-3-N-(3-methoxypropyl)-3-N,5-dimethylbenzene-1,3-diamine (PubChem CID 134606162) has the molecular formula C20H23F2N5O and a molecular weight of 387.43 g/mol. Its IUPAC name is 1-N-[1-(3,5-difluorophenyl)-1,2,4-triazol-3-yl]-3-N-(3-methoxypropyl)-3-N,5-dimethylbenzene-1,3-diamine.
| Compound Name | 1-N-[1-(3,5-difluorophenyl)-1,2,4-triazol-3-yl]-3-N-(3-methoxypropyl)-3-N,5-dimethylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 134606162 |
| Molecular Formula | C20H23F2N5O |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 1-N-[1-(3,5-difluorophenyl)-1,2,4-triazol-3-yl]-3-N-(3-methoxypropyl)-3-N,5-dimethylbenzene-1,3-diamine |
| SMILES | COCCCN(C)c1cc(C)cc(Nc2ncn(-c3cc(F)cc(F)c3)n2)c1 |
| InChI | InChI=1S/C20H23F2N5O/c1-14-7-17(12-18(8-14)26(2)5-4-6-28-3)24-20-23-13-27(25-20)19-10-15(21)9-16(22)11-19/h7-13H,4-6H2,1-3H3,(H,24,25) |
| InChIKey | PQWXSDNFXADMKB-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|