C18H18F2N2O5 — CID 134610744
4-[2-(4-benzyl-2-oxo-1,3-oxazolidin-3-yl)-2-oxoethylidene]-3,3-difluoropiperidine-1-carboxylic acid (PubChem CID 134610744) has the molecular formula C18H18F2N2O5 and a molecular weight of 380.35 g/mol. Its IUPAC name is 4-[2-(4-benzyl-2-oxo-1,3-oxazolidin-3-yl)-2-oxoethylidene]-3,3-difluoropiperidine-1-carboxylic acid.
| Compound Name | 4-[2-(4-benzyl-2-oxo-1,3-oxazolidin-3-yl)-2-oxoethylidene]-3,3-difluoropiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 134610744 |
| Molecular Formula | C18H18F2N2O5 |
| Molecular Weight | 380.35 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 4-[2-(4-benzyl-2-oxo-1,3-oxazolidin-3-yl)-2-oxoethylidene]-3,3-difluoropiperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCC(=CC(=O)N2C(=O)OCC2Cc2ccccc2)C(F)(F)C1 |
| InChI | InChI=1S/C18H18F2N2O5/c19-18(20)11-21(16(24)25)7-6-13(18)9-15(23)22-14(10-27-17(22)26)8-12-4-2-1-3-5-12/h1-5,9,14H,6-8,10-11H2,(H,24,25) |
| InChIKey | NDOAZTGUFGLFOR-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.35 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|