C7H7F3N2O4S — CID 134664231
3-hydroxy-2-methyl-5-(trifluoromethoxy)pyridine-4-sulfonamide (PubChem CID 134664231) has the molecular formula C7H7F3N2O4S and a molecular weight of 272.20 g/mol. Its IUPAC name is 3-hydroxy-2-methyl-5-(trifluoromethoxy)pyridine-4-sulfonamide.
| Compound Name | 3-hydroxy-2-methyl-5-(trifluoromethoxy)pyridine-4-sulfonamide |
|---|---|
| PubChem CID | 134664231 |
| Molecular Formula | C7H7F3N2O4S |
| Molecular Weight | 272.20 g/mol |
| Exact Mass | 272.01 |
| IUPAC Name | 3-hydroxy-2-methyl-5-(trifluoromethoxy)pyridine-4-sulfonamide |
| SMILES | Cc1ncc(OC(F)(F)F)c(S(N)(=O)=O)c1O |
| InChI | InChI=1S/C7H7F3N2O4S/c1-3-5(13)6(17(11,14)15)4(2-12-3)16-7(8,9)10/h2,13H,1H3,(H2,11,14,15) |
| InChIKey | QAASZKMEOVSFEM-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 102.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.20 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |